ChemNet > CAS > 26820-31-5 2-[(4-chlorophenyl)thio]-3-nitropyridine
26820-31-5 2-[(4-chlorophenyl)thio]-3-nitropyridine
نام محصول |
2-[(4-chlorophenyl)thio]-3-nitropyridine |
نام انگلیسی |
2-[(4-chlorophenyl)thio]-3-nitropyridine;2-[(4-chlorophenyl)sulfanyl]-3-nitropyridine |
میدان مغناطیسی |
C11H7ClN2O2S |
وزن مولکولی |
266.7035 |
InChI |
InChI=1/C11H7ClN2O2S/c12-8-3-5-9(6-4-8)17-11-10(14(15)16)2-1-7-13-11/h1-7H |
شماره سیایاس |
26820-31-5 |
ساختار مولکولی |
|
تراکم |
1.47g/cm3 |
نقطه ذوب |
127℃ |
نقطه غلیان |
398.4°C at 760 mmHg |
ضریب شکست |
1.68 |
نقطه اشتعال |
194.8°C |
فشار بخار |
3.39E-06mmHg at 25°C |
خطر نمادها |
|
کدهای خطر |
|
توضیحات ایمنی |
S24/25:Avoid contact with skin and eyes.;
|
|